Difference between revisions of "GLUCOSAMINYL-14-ETCETERA-MANNOSYL-R"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9090 == * smiles: ** ccc5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)ccc=c(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4...") |
(Created page with "Category:metabolite == Metabolite CPD-12365 == * common-name: ** 8-oxo-dgmp * smiles: ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** aq...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-12365 == |
| + | * common-name: | ||
| + | ** 8-oxo-dgmp | ||
* smiles: | * smiles: | ||
| − | ** | + | ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23))) |
| − | * | + | * inchi-key: |
| − | ** | + | ** aqivlflyhyfrku-vpeninkcsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 361.207 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-14205]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-11396]] |
| − | * [[RXN- | + | * [[RXN-12816]] |
| + | * [[RXN-14205]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=8-oxo-dgmp}} |
| − | {{#set: molecular-weight= | + | {{#set: inchi-key=inchikey=aqivlflyhyfrku-vpeninkcsa-l}} |
| + | {{#set: molecular-weight=361.207}} | ||
Revision as of 14:54, 5 January 2021
Contents
Metabolite CPD-12365
- common-name:
- 8-oxo-dgmp
- smiles:
- c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23)))
- inchi-key:
- aqivlflyhyfrku-vpeninkcsa-l
- molecular-weight:
- 361.207
