Difference between revisions of "GLUCOSAMINYL-14-ETCETERA-MANNOSYL-R"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-formyl-L-methionyl-tRNAfmet == * common-name: ** an n-formyl-l-methionyl-[initiator trnamet] == Reaction(s) known to consume the compou...") |
(Created page with "Category:metabolite == Metabolite CPD-734 == * common-name: ** (-)-jasmonate * smiles: ** ccc=ccc1(c(=o)ccc1cc([o-])=o) * inchi-key: ** znjfbwydhiglcu-hwkxxfmvsa-m * molec...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-734 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (-)-jasmonate |
| + | * smiles: | ||
| + | ** ccc=ccc1(c(=o)ccc1cc([o-])=o) | ||
| + | * inchi-key: | ||
| + | ** znjfbwydhiglcu-hwkxxfmvsa-m | ||
| + | * molecular-weight: | ||
| + | ** 209.264 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-10767]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(-)-jasmonate}} |
| + | {{#set: inchi-key=inchikey=znjfbwydhiglcu-hwkxxfmvsa-m}} | ||
| + | {{#set: molecular-weight=209.264}} | ||
Revision as of 13:08, 14 January 2021
Contents
Metabolite CPD-734
- common-name:
- (-)-jasmonate
- smiles:
- ccc=ccc1(c(=o)ccc1cc([o-])=o)
- inchi-key:
- znjfbwydhiglcu-hwkxxfmvsa-m
- molecular-weight:
- 209.264
