Difference between revisions of "GLUCOSAMINYL-ETCETERA-MANNOSYL-R"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-323 RXN66-323] == * direction: ** left-to-right * common-name: ** cholesterol:nadp+ δ7...")
(Created page with "Category:metabolite == Metabolite R-2-HYDROXYGLUTARATE == * common-name: ** (r)-2-hydroxyglutarate * smiles: ** c(ccc(c([o-])=o)o)([o-])=o * inchi-key: ** hwxbtnavrsuojr-g...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-323 RXN66-323] ==
+
== Metabolite R-2-HYDROXYGLUTARATE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** cholesterol:nadp+ δ7 -oxidoreductase
+
** (r)-2-hydroxyglutarate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.3.1.21 ec-1.3.1.21]
+
** c(ccc(c([o-])=o)o)([o-])=o
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-4187]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CHOLESTEROL]][c] '''+''' 1 [[NADP]][c]
+
** hwxbtnavrsuojr-gsvougtgsa-l
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ02661]]
+
** 146.099
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[KETOGLUTREDUCT-RXN]]
−
** Category: [[orthology]]
+
* [[RXN-14932]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
* [[KETOGLUTREDUCT-RXN]]
−
* [[PWY66-341]], cholesterol biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-341 PWY66-341]
+
== Reaction(s) of unknown directionality ==
−
** '''14''' reactions found over '''18''' reactions in the full pathway
+
{{#set: common-name=(r)-2-hydroxyglutarate}}
−
* [[PWY66-3]], cholesterol biosynthesis II (via 24,25-dihydrolanosterol): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-3 PWY66-3]
+
{{#set: inchi-key=inchikey=hwxbtnavrsuojr-gsvougtgsa-l}}
−
** '''12''' reactions found over '''18''' reactions in the full pathway
+
{{#set: molecular-weight=146.099}}
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=23984 23984]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R01456 R01456]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=cholesterol:nadp+ δ7 -oxidoreductase}}
 
−
{{#set: ec-number=ec-1.3.1.21}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Revision as of 20:35, 18 December 2020

Metabolite R-2-HYDROXYGLUTARATE

  • common-name:
    • (r)-2-hydroxyglutarate
  • smiles:
    • c(ccc(c([o-])=o)o)([o-])=o
  • inchi-key:
    • hwxbtnavrsuojr-gsvougtgsa-l
  • molecular-weight:
    • 146.099

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=GLUCOSAMINYL-ETCETERA-MANNOSYL-R&oldid=47406"