Difference between revisions of "GLUCOSE1PMETAB-PWY"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9096 CPD-9096] ==
+== Pathway GLUCOSE1PMETAB-PWY ==
+* taxonomic-range:
+** tax-2157
+** tax-2759
+** tax-2
 * common-name:
-** bacteriopheophytin a
+** glucose and glucose-1-phosphate degradation
-* smiles:
+== Reaction(s) found ==
-** ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(c(ccc(occ=c(c)cccc(c)cccc(c)cccc(c)c)=o)c(c)c(=n2)c=c3(c(c)=c(c(c)=o)c(n3)=cc(=n4)c(c)5)))n6))))
+* [[GLUCOKIN-RXN]]
-* inchi-key:
+* [[GLUCONOLACT-RXN]]
-** qgudpqyomulita-zasykxldsa-n
+* [[PHOSPHOGLUCMUT-RXN]]
-* molecular-weight:
+== Reaction(s) not found ==
-** 888.221
+* [NoneGLUCOSE-1-PHOSPHAT-RXN GLUCOSE-1-PHOSPHAT-RXN]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN0-6373 RXN0-6373]
-== Reaction(s) known to produce the compound ==
+{{#set: taxonomic-range=tax-2|tax-2157|tax-2759}}
-* [[RXN-17427]]
+{{#set: common-name=glucose and glucose-1-phosphate degradation}}
-* [[RXN-8796]]
+{{#set: nb reaction found=3}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.6}}
-{{#set: common-name=bacteriopheophytin a}}
+{{#set: nb total reaction=5}}
-{{#set: inchi-key=inchikey=qgudpqyomulita-zasykxldsa-n}}
-{{#set: molecular-weight=888.221}}