Difference between revisions of "GLUCOSE1PMETAB-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PARATHION PARATHION] == * common-name: ** parathion * smiles: ** ccop(oc1(c=cc(=cc=1)[n+](=o)[o...")
 
(Created page with "Category:pathway == Pathway GLUCOSE1PMETAB-PWY == * taxonomic-range: ** tax-2157 ** tax-2759 ** tax-2 * common-name: ** glucose and glucose-1-phosphate degradation == Reac...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PARATHION PARATHION] ==
+
== Pathway GLUCOSE1PMETAB-PWY ==
 +
* taxonomic-range:
 +
** tax-2157
 +
** tax-2759
 +
** tax-2
 
* common-name:
 
* common-name:
** parathion
+
** glucose and glucose-1-phosphate degradation
* smiles:
+
== Reaction(s) found ==
** ccop(oc1(c=cc(=cc=1)[n+](=o)[o-]))(occ)=s
+
* [[GLUCOKIN-RXN]]
* inchi-key:
+
* [[GLUCONOLACT-RXN]]
** lccncvornkjirz-uhfffaoysa-n
+
* [[PHOSPHOGLUCMUT-RXN]]
* molecular-weight:
+
== Reaction(s) not found ==
** 291.258
+
* [NoneGLUCOSE-1-PHOSPHAT-RXN GLUCOSE-1-PHOSPHAT-RXN]
== Reaction(s) known to consume the compound ==
+
* [NoneRXN0-6373 RXN0-6373]
* [[ARYLDIALKYL-PHOSPHATASE-RXN]]
+
{{#set: taxonomic-range=tax-2|tax-2157|tax-2759}}
== Reaction(s) known to produce the compound ==
+
{{#set: common-name=glucose and glucose-1-phosphate degradation}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb reaction found=3}}
{{#set: common-name=parathion}}
+
{{#set: completion rate=0.6}}
{{#set: inchi-key=inchikey=lccncvornkjirz-uhfffaoysa-n}}
+
{{#set: nb total reaction=5}}
{{#set: molecular-weight=291.258}}
 

Latest revision as of 10:58, 18 March 2021

Pathway GLUCOSE1PMETAB-PWY

  • taxonomic-range:
    • tax-2157
    • tax-2759
    • tax-2
  • common-name:
    • glucose and glucose-1-phosphate degradation

Reaction(s) found

Reaction(s) not found

  • [NoneGLUCOSE-1-PHOSPHAT-RXN GLUCOSE-1-PHOSPHAT-RXN]
  • [NoneRXN0-6373 RXN0-6373]