Difference between revisions of "GLUCOSE1PMETAB-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PARATHION PARATHION] == * common-name: ** parathion * smiles: ** ccop(oc1(c=cc(=cc=1)[n+](=o)[o...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9096 CPD-9096] == * common-name: ** bacteriopheophytin a * smiles: ** ccc5(c4(=cc6(=c(c)c1(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PARATHION PARATHION] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9096 CPD-9096] ==
 
* common-name:
 
* common-name:
** parathion
+
** bacteriopheophytin a
 
* smiles:
 
* smiles:
** ccop(oc1(c=cc(=cc=1)[n+](=o)[o-]))(occ)=s
+
** ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(c(ccc(occ=c(c)cccc(c)cccc(c)cccc(c)c)=o)c(c)c(=n2)c=c3(c(c)=c(c(c)=o)c(n3)=cc(=n4)c(c)5)))n6))))
 
* inchi-key:
 
* inchi-key:
** lccncvornkjirz-uhfffaoysa-n
+
** qgudpqyomulita-zasykxldsa-n
 
* molecular-weight:
 
* molecular-weight:
** 291.258
+
** 888.221
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ARYLDIALKYL-PHOSPHATASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17427]]
 +
* [[RXN-8796]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=parathion}}
+
{{#set: common-name=bacteriopheophytin a}}
{{#set: inchi-key=inchikey=lccncvornkjirz-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=qgudpqyomulita-zasykxldsa-n}}
{{#set: molecular-weight=291.258}}
+
{{#set: molecular-weight=888.221}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-9096

  • common-name:
    • bacteriopheophytin a
  • smiles:
    • ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(c(ccc(occ=c(c)cccc(c)cccc(c)cccc(c)c)=o)c(c)c(=n2)c=c3(c(c)=c(c(c)=o)c(n3)=cc(=n4)c(c)5)))n6))))
  • inchi-key:
    • qgudpqyomulita-zasykxldsa-n
  • molecular-weight:
    • 888.221

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality