Difference between revisions of "GLUDEG-II-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINYL-PYRUVATE 3-SULFINYL-PYRUVATE] == * common-name: ** 3-sulfinopyruvate * smiles: ** c(...")
 
(Created page with "Category:pathway == Pathway GLUDEG-II-PWY == * taxonomic-range: ** tax-1239 ** tax-1224 * common-name: ** l-glutamate degradation vii (to butanoate) == Reaction(s) found =...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINYL-PYRUVATE 3-SULFINYL-PYRUVATE] ==
+
== Pathway GLUDEG-II-PWY ==
 +
* taxonomic-range:
 +
** tax-1239
 +
** tax-1224
 
* common-name:
 
* common-name:
** 3-sulfinopyruvate
+
** l-glutamate degradation vii (to butanoate)
* smiles:
+
== Reaction(s) found ==
** c(s([o-])=o)c(=o)c(=o)[o-]
+
* [[HYDROG-RXN]]
* inchi-key:
+
* [[PYRUFLAVREDUCT-RXN]]
** jxylqemxcaamol-uhfffaoysa-l
+
== Reaction(s) not found ==
* molecular-weight:
+
* [NoneRXN-16834 RXN-16834]
** 150.106
+
{{#set: taxonomic-range=tax-1239|tax-1224}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=l-glutamate degradation vii (to butanoate)}}
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
+
{{#set: nb reaction found=2}}
== Reaction(s) known to produce the compound ==
+
{{#set: completion rate=0.67}}
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
+
{{#set: nb total reaction=3}}
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=3-sulfinopyruvate}}
 
{{#set: inchi-key=inchikey=jxylqemxcaamol-uhfffaoysa-l}}
 
{{#set: molecular-weight=150.106}}
 

Latest revision as of 10:58, 18 March 2021

Pathway GLUDEG-II-PWY

  • taxonomic-range:
    • tax-1239
    • tax-1224
  • common-name:
    • l-glutamate degradation vii (to butanoate)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-16834 RXN-16834]