Difference between revisions of "GLUDEG-II-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINYL-PYRUVATE 3-SULFINYL-PYRUVATE] == * common-name: ** 3-sulfinopyruvate * smiles: ** c(...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Glucopyranose Glucopyranose] == * common-name: ** d-glucopyranose == Reaction(s) known to consu...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINYL-PYRUVATE 3-SULFINYL-PYRUVATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Glucopyranose Glucopyranose] ==
 
* common-name:
 
* common-name:
−
** 3-sulfinopyruvate
+
** d-glucopyranose
−
* smiles:
 
−
** c(s([o-])=o)c(=o)c(=o)[o-]
 
−
* inchi-key:
 
−
** jxylqemxcaamol-uhfffaoysa-l
 
−
* molecular-weight:
 
−
** 150.106
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
+
* [[GLUCISOM-RXN]]
 +
* [[GLUCOKIN-RXN]]
 +
* [[LACTOSE-SYNTHASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[2.3.1.91-RXN]]
 +
* [[3.2.1.21-RXN]]
 +
* [[3.2.1.39-RXN]]
 +
* [[3.2.1.84-RXN]]
 +
* [[ALPHAGALACTOSID-RXN]]
 +
* [[BETAGALACTOSID-RXN]]
 +
* [[GLUCISOM-RXN]]
 +
* [[GLUCOSYLCERAMIDASE-RXN]]
 +
* [[KETOLACTOSE-RXN]]
 +
* [[MALTODEXGLUCOSID-RXN]]
 +
* [[RXN-10769]]
 +
* [[RXN-10773]]
 +
* [[RXN-13600]]
 +
* [[RXN-13602]]
 +
* [[RXN-13603]]
 +
* [[RXN-14179]]
 +
* [[RXN-14281]]
 +
* [[RXN-14282]]
 +
* [[RXN-14283]]
 +
* [[RXN-15910]]
 +
* [[RXN-5341]]
 +
* [[RXN-8036]]
 +
* [[RXN-9674]]
 +
* [[RXN0-5183]]
 +
* [[RXN0-5395]]
 +
* [[RXN66-526]]
 +
</div>
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=3-sulfinopyruvate}}
+
{{#set: common-name=d-glucopyranose}}
−
{{#set: inchi-key=inchikey=jxylqemxcaamol-uhfffaoysa-l}}
 
−
{{#set: molecular-weight=150.106}}
 

Revision as of 14:18, 26 August 2019

Metabolite Glucopyranose

  • common-name:
    • d-glucopyranose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=GLUDEG-II-PWY&oldid=13461"