Difference between revisions of "GLURS-RXN"
Jump to navigation
Jump to search
(Created page with "{{#ask: Category:reaction reconstruction tool::curation | ?common-name | ?ec-number | ?reconstruction category | ?reconstruction source | ?reconstruction comment | ?nb...") |
(Created page with "Category:metabolite == Metabolite CPD-12116 == * common-name: ** demethylmenaquinol-6 * smiles: ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1...") |
||
Line 1: | Line 1: | ||
− | + | [[Category:metabolite]] | |
− | + | == Metabolite CPD-12116 == | |
− | + | * common-name: | |
− | + | ** demethylmenaquinol-6 | |
− | + | * smiles: | |
− | + | ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c | |
− | + | * inchi-key: | |
− | + | ** ufaxpzazhzpelj-rotsudqpsa-n | |
− | }} | + | * molecular-weight: |
+ | ** 568.881 | ||
+ | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-9220]] | ||
+ | == Reaction(s) known to produce the compound == | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=demethylmenaquinol-6}} | ||
+ | {{#set: inchi-key=inchikey=ufaxpzazhzpelj-rotsudqpsa-n}} | ||
+ | {{#set: molecular-weight=568.881}} |
Revision as of 08:32, 15 March 2021
Contents
Metabolite CPD-12116
- common-name:
- demethylmenaquinol-6
- smiles:
- cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c
- inchi-key:
- ufaxpzazhzpelj-rotsudqpsa-n
- molecular-weight:
- 568.881