Difference between revisions of "GLUTACONYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4201 == * common-name: ** n6-(δ2-isopentenyl)-adenosine 5'-triphosphate * smiles: ** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)...")
(Created page with "Category:metabolite == Metabolite Octanoylated-Gcv-H == * common-name: ** a [glycine-cleavage complex h protein] n6-octanoyl-l-lysine == Reaction(s) known to consume the c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-4201 ==
+
== Metabolite Octanoylated-Gcv-H ==
 
* common-name:
 
* common-name:
** n6-(δ2-isopentenyl)-adenosine 5'-triphosphate
+
** a [glycine-cleavage complex h protein] n6-octanoyl-l-lysine
* smiles:
 
** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)([o-])op(=o)([o-])o)([o-])=o)o)o))c=nc=23)))c
 
* inchi-key:
 
** oplvztyvquwkhb-sdbhatresa-k
 
* molecular-weight:
 
** 572.278
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-14950]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-4303]]
+
* [[RXN-13037]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n6-(δ2-isopentenyl)-adenosine 5'-triphosphate}}
+
{{#set: common-name=a [glycine-cleavage complex h protein] n6-octanoyl-l-lysine}}
{{#set: inchi-key=inchikey=oplvztyvquwkhb-sdbhatresa-k}}
 
{{#set: molecular-weight=572.278}}
 

Revision as of 08:24, 15 March 2021

Metabolite Octanoylated-Gcv-H

  • common-name:
    • a [glycine-cleavage complex h protein] n6-octanoyl-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [glycine-cleavage complex h protein] n6-octanoyl-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.