Difference between revisions of "GLUTACONYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Oxidized-adrenal-ferredoxins == * common-name: ** an oxidized adrenodoxin == Reaction(s) known to consume the compound == * RXN-13685...") |
(Created page with "Category:metabolite == Metabolite ITP == * common-name: ** itp * smiles: ** c(op(=o)([o-])op([o-])(=o)op([o-])([o-])=o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-ke...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ITP == |
* common-name: | * common-name: | ||
| − | ** | + | ** itp |
| + | * smiles: | ||
| + | ** c(op(=o)([o-])op([o-])(=o)op([o-])([o-])=o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) | ||
| + | * inchi-key: | ||
| + | ** haejpqiatwhalx-kqynxxcusa-j | ||
| + | * molecular-weight: | ||
| + | ** 504.137 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[ATP-DEAMINASE-RXN]] |
| + | * [[ITCY]] | ||
| + | * [[ITPP]] | ||
| + | * [[ITUP]] | ||
| + | * [[RXN-14120]] | ||
| + | * [[RXN0-5073]] | ||
| + | * [[RXN0-6382]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[ATID]] | ||
| + | * [[ATIDm]] | ||
| + | * [[ATP-DEAMINASE-RXN]] | ||
| + | * [[RXN-14120]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=itp}} |
| + | {{#set: inchi-key=inchikey=haejpqiatwhalx-kqynxxcusa-j}} | ||
| + | {{#set: molecular-weight=504.137}} | ||
Revision as of 14:54, 5 January 2021
Contents
Metabolite ITP
- common-name:
- itp
- smiles:
- c(op(=o)([o-])op([o-])(=o)op([o-])([o-])=o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
- inchi-key:
- haejpqiatwhalx-kqynxxcusa-j
- molecular-weight:
- 504.137
