Difference between revisions of "GLUTAMATE-DEG1-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11407 CPD-11407] == * common-name: ** thyroxine sulfate * smiles: ** c2(c(i)=c(oc1(c=c(c(os...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HCN HCN] == * common-name: ** hydrogen cyanide * smiles: ** c#n * inchi-key: ** lelowrisymnnsu-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11407 CPD-11407] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HCN HCN] ==
 
* common-name:
 
* common-name:
** thyroxine sulfate
+
** hydrogen cyanide
 
* smiles:
 
* smiles:
** c2(c(i)=c(oc1(c=c(c(os(=o)(=o)[o-])=c(c=1)i)i))c(=cc=2cc(c(=o)[o-])[n+])i)
+
** c#n
 
* inchi-key:
 
* inchi-key:
** qyxijuzwssqict-lbprgkrzsa-m
+
** lelowrisymnnsu-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 855.924
+
** 27.026
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN0-6359]]
 +
* [[THIOSULFATE-SULFURTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10614]]
+
* [[ETHYL-RXN]]
 +
* [[RXN-13600]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=thyroxine sulfate}}
+
{{#set: common-name=hydrogen cyanide}}
{{#set: inchi-key=inchikey=qyxijuzwssqict-lbprgkrzsa-m}}
+
{{#set: inchi-key=inchikey=lelowrisymnnsu-uhfffaoysa-n}}
{{#set: molecular-weight=855.924}}
+
{{#set: molecular-weight=27.026}}

Revision as of 14:19, 26 August 2019

Metabolite HCN

  • common-name:
    • hydrogen cyanide
  • smiles:
    • c#n
  • inchi-key:
    • lelowrisymnnsu-uhfffaoysa-n
  • molecular-weight:
    • 27.026

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality