Difference between revisions of "GLUTARYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ07978 == * transcription-direction: ** negative * right-end-position: ** 177076 * left-end-position: ** 172472 * centisome-position: ** 38.702003...")
(Created page with "Category:metabolite == Metabolite GLUTARYL-COA == * common-name: ** glutaryl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cccc(=o)[o-])=o)cop(=o)(op(=o)(occ1(c(op([o-])(=...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ07978 ==
+
== Metabolite GLUTARYL-COA ==
* transcription-direction:
+
* common-name:
** negative
+
** glutaryl-coa
* right-end-position:
+
* smiles:
** 177076
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(cccc(=o)[o-])=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
* left-end-position:
+
* inchi-key:
** 172472
+
** sykwlijqehrdnh-ckrmaksasa-i
* centisome-position:
+
* molecular-weight:
** 38.702003   
+
** 876.595
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[GLUTARYL-COA-DEHYDROG-RXN]]
== Reaction(s) associated ==
+
* [[GLUTARYL-COA-DEHYDROGENASE-RXN]]
* [[3.1.3.16-RXN]]
+
* [[RXN-8032]]
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[2-KETO-ADIPATE-DEHYDROG-RXN]]
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
+
* [[GLUTARYL-COA-DEHYDROG-RXN]]
** Category: [[annotation]]
+
* [[GLUTARYL-COA-DEHYDROGENASE-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-8032]]
* [[PROTEIN-TYROSINE-PHOSPHATASE-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=glutaryl-coa}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=sykwlijqehrdnh-ckrmaksasa-i}}
{{#set: transcription-direction=negative}}
+
{{#set: molecular-weight=876.595}}
{{#set: right-end-position=177076}}
 
{{#set: left-end-position=172472}}
 
{{#set: centisome-position=38.702003    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=3}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite GLUTARYL-COA

  • common-name:
    • glutaryl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(cccc(=o)[o-])=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • sykwlijqehrdnh-ckrmaksasa-i
  • molecular-weight:
    • 876.595

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality