Difference between revisions of "GLUTARYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ00878 == * transcription-direction: ** negative * right-end-position: ** 91451 * left-end-position: ** 80082 * centisome-position: ** 49.763554...")
(Created page with "Category:metabolite == Metabolite GLUTARYL-COA == * common-name: ** glutaryl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cccc(=o)[o-])=o)cop(=o)(op(=o)(occ1(c(op([o-])(=...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ00878 ==
+
== Metabolite GLUTARYL-COA ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** glutaryl-coa
−
* right-end-position:
+
* smiles:
−
** 91451
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(cccc(=o)[o-])=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
* left-end-position:
+
* inchi-key:
−
** 80082
+
** sykwlijqehrdnh-ckrmaksasa-i
−
* centisome-position:
+
* molecular-weight:
−
** 49.763554   
+
** 876.595
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[GLUTARYL-COA-DEHYDROG-RXN]]
−
== Reaction(s) associated ==
+
* [[GLUTARYL-COA-DEHYDROGENASE-RXN]]
−
* [[1.1.1.8-RXN]]
+
* [[RXN-8032]]
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[2-KETO-ADIPATE-DEHYDROG-RXN]]
−
** Category: [[orthology]]
+
* [[GLUTARYL-COA-DEHYDROG-RXN]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[GLUTARYL-COA-DEHYDROGENASE-RXN]]
−
* [[6PGLUCONDEHYDROG-RXN]]
+
* [[RXN-8032]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=glutaryl-coa}}
−
* [[G3PD2]]
+
{{#set: inchi-key=inchikey=sykwlijqehrdnh-ckrmaksasa-i}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=876.595}}
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
* [[GLYC3PDEHYDROGBIOSYN-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-9952]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-6118]]
 
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-7385]]
 
−
** '''7''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-7411]]
 
−
** '''4''' reactions found over '''5''' reactions in the full pathway
 
−
* [[P122-PWY]]
 
−
** '''16''' reactions found over '''18''' reactions in the full pathway
 
−
* [[PWY-7902]]
 
−
** '''2''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-5981]]
 
−
** '''3''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY0-1319]]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-5667]]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
* [[OXIDATIVEPENT-PWY]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=91451}}
 
−
{{#set: left-end-position=80082}}
 
−
{{#set: centisome-position=49.763554    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=5}}
 
−
{{#set: nb pathway associated=9}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite GLUTARYL-COA

  • common-name:
    • glutaryl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(cccc(=o)[o-])=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • sykwlijqehrdnh-ckrmaksasa-i
  • molecular-weight:
    • 876.595

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=GLUTARYL-COA&oldid=137226"