Difference between revisions of "GLUTARYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18539 == * common-name: ** (r)-n-formyl-β-hydroxy-l-kynurenine * smiles: ** [ch](=o)nc1(c=cc=cc=1c(=o)c(o)c([n+])c(=o)[o-]) * in...")
(Created page with "Category:metabolite == Metabolite GLUTARYL-COA == * common-name: ** glutaryl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cccc(=o)[o-])=o)cop(=o)(op(=o)(occ1(c(op([o-])(=...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-18539 ==
+
== Metabolite GLUTARYL-COA ==
 
* common-name:
 
* common-name:
** (r)-n-formyl-β-hydroxy-l-kynurenine
+
** glutaryl-coa
 
* smiles:
 
* smiles:
** [ch](=o)nc1(c=cc=cc=1c(=o)c(o)c([n+])c(=o)[o-])
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(cccc(=o)[o-])=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** gadduklgjyjxsl-wcbmzhexsa-n
+
** sykwlijqehrdnh-ckrmaksasa-i
 
* molecular-weight:
 
* molecular-weight:
** 252.226
+
** 876.595
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17150]]
+
* [[GLUTARYL-COA-DEHYDROG-RXN]]
 +
* [[GLUTARYL-COA-DEHYDROGENASE-RXN]]
 +
* [[RXN-8032]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2-KETO-ADIPATE-DEHYDROG-RXN]]
 +
* [[GLUTARYL-COA-DEHYDROG-RXN]]
 +
* [[GLUTARYL-COA-DEHYDROGENASE-RXN]]
 +
* [[RXN-8032]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(r)-n-formyl-β-hydroxy-l-kynurenine}}
+
{{#set: common-name=glutaryl-coa}}
{{#set: inchi-key=inchikey=gadduklgjyjxsl-wcbmzhexsa-n}}
+
{{#set: inchi-key=inchikey=sykwlijqehrdnh-ckrmaksasa-i}}
{{#set: molecular-weight=252.226}}
+
{{#set: molecular-weight=876.595}}

Latest revision as of 11:12, 18 March 2021

Metabolite GLUTARYL-COA

  • common-name:
    • glutaryl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(cccc(=o)[o-])=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • sykwlijqehrdnh-ckrmaksasa-i
  • molecular-weight:
    • 876.595

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality