Difference between revisions of "GLUTATHIONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ12409 == * transcription-direction: ** positive * right-end-position: ** 270862 * left-end-position: ** 258302 * centisome-position: ** 72.107285...")
(Created page with "Category:metabolite == Metabolite GLUTATHIONE == * common-name: ** glutathione * smiles: ** c(s)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o * inchi-key: ** rwsxrvcmgqzwbv-...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ12409 ==
+
== Metabolite GLUTATHIONE ==
* transcription-direction:
+
* common-name:
** positive
+
** glutathione
* right-end-position:
+
* smiles:
** 270862
+
** c(s)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
* left-end-position:
+
* inchi-key:
** 258302
+
** rwsxrvcmgqzwbv-wdskdsinsa-m
* centisome-position:
+
* molecular-weight:
** 72.107285   
+
** 306.313
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[1.11.1.12-RXN]]
== Reaction(s) associated ==
+
* [[1.8.4.9-RXN]]
* [[CHD-RXN]]
+
* [[1.8.5.1-RXN]]
** Category: [[annotation]]
+
* [[2.3.2.15-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[GLUTATHIONE-PEROXIDASE-RXN]]
* [[RXN0-7230]]
+
* [[GLYOXI-RXN]]
** Category: [[annotation]]
+
* [[GSHTRAN-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[GST-RXN]]
== Pathway(s) associated ==
+
* [[GTHP]]
* [[BETSYN-PWY]]
+
* [[LEUKOTRIENE-C4-SYNTHASE-RXN]]
** '''2''' reactions found over '''2''' reactions in the full pathway
+
* [[RXN-12618]]
* [[CHOLINE-BETAINE-ANA-PWY]]
+
* [[RXN-13673]]
** '''2''' reactions found over '''2''' reactions in the full pathway
+
* [[RXN-15680]]
{{#set: transcription-direction=positive}}
+
* [[RXN-18092]]
{{#set: right-end-position=270862}}
+
* [[RXN-6601]]
{{#set: left-end-position=258302}}
+
* [[RXN-9157]]
{{#set: centisome-position=72.107285    }}
+
== Reaction(s) known to produce the compound ==
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[GDR]]
{{#set: nb reaction associated=2}}
+
* [[GDR_LPAREN_nadp_RPAREN_]]
{{#set: nb pathway associated=2}}
+
* [[GDR_LPAREN_nadp_RPAREN_h]]
 +
* [[GDR_LPAREN_nadp_RPAREN_m]]
 +
* [[GDRh]]
 +
* [[GDRm]]
 +
* [[GLUTATHIONE-REDUCT-NADPH-RXN]]
 +
* [[GLUTATHIONE-SYN-RXN]]
 +
* [[GLYOXI-RXN]]
 +
* [[GLYOXII-RXN]]
 +
* [[GST-RXN]]
 +
* [[RXN-13161]]
 +
* [[RXN-7919]]
 +
* [[S-FORMYLGLUTATHIONE-HYDROLASE-RXN]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=glutathione}}
 +
{{#set: inchi-key=inchikey=rwsxrvcmgqzwbv-wdskdsinsa-m}}
 +
{{#set: molecular-weight=306.313}}

Latest revision as of 11:13, 18 March 2021