Difference between revisions of "GLUTATHIONESYN-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-36 CPDQT-36] == * common-name: ** 3-[(3'-methylthio)propyl]malate * smiles: ** c(c(cccsc)...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=mRNAs-With-PolyA-Tails mRNAs-With-PolyA-Tails] == * common-name: ** a mrna with poly(a) tail ==...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-36 CPDQT-36] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=mRNAs-With-PolyA-Tails mRNAs-With-PolyA-Tails] ==
 
* common-name:
 
* common-name:
** 3-[(3'-methylthio)propyl]malate
+
** a mrna with poly(a) tail
* smiles:
 
** c(c(cccsc)c(o)c(=o)[o-])(=o)[o-]
 
* inchi-key:
 
** sqxviiopmysncp-uhfffaoysa-l
 
* molecular-weight:
 
** 220.24
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-18208]]
+
* [[3.1.13.4-RXN]]
* [[RXNQT-4165]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-18208]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-[(3'-methylthio)propyl]malate}}
+
{{#set: common-name=a mrna with poly(a) tail}}
{{#set: inchi-key=inchikey=sqxviiopmysncp-uhfffaoysa-l}}
 
{{#set: molecular-weight=220.24}}
 

Revision as of 14:19, 26 August 2019

Metabolite mRNAs-With-PolyA-Tails

  • common-name:
    • a mrna with poly(a) tail

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality