Difference between revisions of "GLUTATHIONESYN-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13403 CPD-13403] == * common-name: ** l-alanyl-l-glutamine * smiles: ** cc([n+])c(=o)nc(c([...")
(Created page with "Category:pathway == Pathway GLUTATHIONESYN-PWY == * taxonomic-range: ** tax-2 ** tax-2759 * common-name: ** glutathione biosynthesis == Reaction(s) found == * GLUTATHION...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13403 CPD-13403] ==
+
== Pathway GLUTATHIONESYN-PWY ==
 +
* taxonomic-range:
 +
** tax-2
 +
** tax-2759
 
* common-name:
 
* common-name:
** l-alanyl-l-glutamine
+
** glutathione biosynthesis
* smiles:
+
== Reaction(s) found ==
** cc([n+])c(=o)nc(c([o-])=o)ccc(=o)n
+
* [[GLUTATHIONE-SYN-RXN]]
* inchi-key:
+
* [[GLUTCYSLIG-RXN]]
** hjcmdxdypoufdy-whfbiakzsa-n
+
== Reaction(s) not found ==
* molecular-weight:
+
All reactions of this pathways are in present
** 217.224
+
{{#set: taxonomic-range=tax-2|tax-2759}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=glutathione biosynthesis}}
* [[RXN0-6976]]
+
{{#set: nb reaction found=2}}
== Reaction(s) known to produce the compound ==
+
{{#set: completion rate=1.0}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb total reaction=2}}
{{#set: common-name=l-alanyl-l-glutamine}}
 
{{#set: inchi-key=inchikey=hjcmdxdypoufdy-whfbiakzsa-n}}
 
{{#set: molecular-weight=217.224}}
 

Latest revision as of 10:59, 18 March 2021

Pathway GLUTATHIONESYN-PWY

  • taxonomic-range:
    • tax-2
    • tax-2759
  • common-name:
    • glutathione biosynthesis

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present