Difference between revisions of "GLUTSYN-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-120 CPD1G-120] == * common-name: ** deacetylmycothiol * smiles: ** c(o)c2(c(c(c(nc(=o)c([...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19042 CPD-19042] == * common-name: ** 2-hydroxyisobutyramide * smiles: ** cc(o)(c)c(=o)n *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-120 CPD1G-120] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19042 CPD-19042] ==
 
* common-name:
 
* common-name:
** deacetylmycothiol
+
** 2-hydroxyisobutyramide
 
* smiles:
 
* smiles:
** c(o)c2(c(c(c(nc(=o)c([n+])cs)c(oc1(c(o)c(o)c(o)c(o)c(o)1))o2)o)o)
+
** cc(o)(c)c(=o)n
 
* inchi-key:
 
* inchi-key:
** zgxscmbzzvxwgf-bseffjthsa-o
+
** drymmxubdrjpds-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 445.461
+
** 103.121
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-17608]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN1G-121]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=deacetylmycothiol}}
+
{{#set: common-name=2-hydroxyisobutyramide}}
{{#set: inchi-key=inchikey=zgxscmbzzvxwgf-bseffjthsa-o}}
+
{{#set: inchi-key=inchikey=drymmxubdrjpds-uhfffaoysa-n}}
{{#set: molecular-weight=445.461}}
+
{{#set: molecular-weight=103.121}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-19042

  • common-name:
    • 2-hydroxyisobutyramide
  • smiles:
    • cc(o)(c)c(=o)n
  • inchi-key:
    • drymmxubdrjpds-uhfffaoysa-n
  • molecular-weight:
    • 103.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality