Difference between revisions of "GLUTSYN-PWY"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19042 CPD-19042] == * common-name: ** 2-hydroxyisobutyramide * smiles: ** cc(o)(c)c(=o)n *...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1103 CPD-1103] == * common-name: ** taxiphyllin * smiles: ** c1(c=c(o)c=cc=1c(oc2(oc(co)c(o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1103 CPD-1103] == |
* common-name: | * common-name: | ||
| − | ** | + | ** taxiphyllin |
* smiles: | * smiles: | ||
| − | ** cc(o)( | + | ** c1(c=c(o)c=cc=1c(oc2(oc(co)c(o)c(o)c(o)2))c#n) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** nvltyojhpbmilu-gmdxdwkasa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 311.291 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-13600]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=taxiphyllin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=nvltyojhpbmilu-gmdxdwkasa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=311.291}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-1103
- common-name:
- taxiphyllin
- smiles:
- c1(c=c(o)c=cc=1c(oc2(oc(co)c(o)c(o)c(o)2))c#n)
- inchi-key:
- nvltyojhpbmilu-gmdxdwkasa-n
- molecular-weight:
- 311.291
