Difference between revisions of "GLUTSYN-PWY"

Revision as of 20:18, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1103 CPD-1103] ==
+== Pathway PWY-6174 ==
+* taxonomic-range:
+** tax-2157
 * common-name:
-** taxiphyllin
+** mevalonate pathway ii (archaea)
-* smiles:
+== Reaction(s) found ==
-** c1(c=c(o)c=cc=1c(oc2(oc(co)c(o)c(o)c(o)2))c#n)
+* [[1.1.1.34-RXN]]
-* inchi-key:
+* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
-** nvltyojhpbmilu-gmdxdwkasa-n
+* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
-* molecular-weight:
+* [[IPPISOM-RXN]]
-** 311.291
+* [[MEVALONATE-KINASE-RXN]]
-== Reaction(s) known to consume the compound ==
+* [[RXN-10068]]
-* [[RXN-13600]]
+== Reaction(s) not found ==
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-10067 RXN-10067]
-== Reaction(s) of unknown directionality ==
+{{#set: taxonomic-range=tax-2157}}
-{{#set: common-name=taxiphyllin}}
+{{#set: common-name=mevalonate pathway ii (archaea)}}
-{{#set: inchi-key=inchikey=nvltyojhpbmilu-gmdxdwkasa-n}}
+{{#set: nb reaction found=6}}
-{{#set: molecular-weight=311.291}}
+{{#set: completion rate=0.86}}
+{{#set: nb total reaction=7}}