Difference between revisions of "GLUTSYNIII-PWY"

Revision as of 20:16, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19163 CPD-19163] ==
+== Pathway PWY-6557 ==
+* taxonomic-range:
+** tax-33208
 * common-name:
-** (2e,11z)-octadecenoyl-coa
+** glycosaminoglycan-protein linkage region biosynthesis
-* smiles:
+== Reaction(s) found ==
-** ccccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+* [[2.4.1.134-RXN]]
-* inchi-key:
+* [[2.4.2.26-RXN]]
-** opmpwwfmnywbgf-pkybcsrxsa-j
+== Reaction(s) not found ==
-* molecular-weight:
+* [None2.4.1.135-RXN 2.4.1.135-RXN]
-** 1025.937
+* [None2.4.1.133-RXN 2.4.1.133-RXN]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-33208}}
-* [[RXN-17785]]
+{{#set: common-name=glycosaminoglycan-protein linkage region biosynthesis}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=2}}
-* [[RXN-17784]]
+{{#set: completion rate=0.5}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=4}}
-{{#set: common-name=(2e,11z)-octadecenoyl-coa}}
-{{#set: inchi-key=inchikey=opmpwwfmnywbgf-pkybcsrxsa-j}}
-{{#set: molecular-weight=1025.937}}