Difference between revisions of "GLY"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ04179 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * PROTEIN-KINASE-RXN **...") |
(Created page with "Category:metabolite == Metabolite CPD-12904 == * common-name: ** (2e)-5-methylhexa-2,4-dienoyl-coa * smiles: ** cc(c)=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(o...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-12904 == |
− | == | + | * common-name: |
− | + | ** (2e)-5-methylhexa-2,4-dienoyl-coa | |
− | = | + | * smiles: |
− | + | ** cc(c)=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | |
− | ** | + | * inchi-key: |
− | *** | + | ** ifmyvrqehqtins-meoyllpmsa-j |
− | {{#set: | + | * molecular-weight: |
− | {{#set: | + | ** 871.642 |
+ | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-11919]] | ||
+ | == Reaction(s) known to produce the compound == | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=(2e)-5-methylhexa-2,4-dienoyl-coa}} | ||
+ | {{#set: inchi-key=inchikey=ifmyvrqehqtins-meoyllpmsa-j}} | ||
+ | {{#set: molecular-weight=871.642}} |
Revision as of 20:34, 18 December 2020
Contents
Metabolite CPD-12904
- common-name:
- (2e)-5-methylhexa-2,4-dienoyl-coa
- smiles:
- cc(c)=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- ifmyvrqehqtins-meoyllpmsa-j
- molecular-weight:
- 871.642