Difference between revisions of "GLY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11875 == * common-name: ** normetanephrine * smiles: ** coc1(=c(o)c=cc(c(o)c[n+])=c1) * inchi-key: ** ynyaywlbahxhll-qmmmgpobsa-o * m...")
(Created page with "Category:metabolite == Metabolite 23S-rRNA-pseudouridine2605 == * common-name: ** a pseudouridine2605 in 23s rrna == Reaction(s) known to consume the compound == == Reacti...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11875 ==
+
== Metabolite 23S-rRNA-pseudouridine2605 ==
 
* common-name:
 
* common-name:
** normetanephrine
+
** a pseudouridine2605 in 23s rrna
* smiles:
 
** coc1(=c(o)c=cc(c(o)c[n+])=c1)
 
* inchi-key:
 
** ynyaywlbahxhll-qmmmgpobsa-o
 
* molecular-weight:
 
** 184.214
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10910]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-11836]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=normetanephrine}}
+
{{#set: common-name=a pseudouridine2605 in 23s rrna}}
{{#set: inchi-key=inchikey=ynyaywlbahxhll-qmmmgpobsa-o}}
 
{{#set: molecular-weight=184.214}}
 

Revision as of 18:56, 14 January 2021

Metabolite 23S-rRNA-pseudouridine2605

  • common-name:
    • a pseudouridine2605 in 23s rrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality