Difference between revisions of "GLY-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DEOXYGUANOSINE == * common-name: ** 2'-deoxyguanosine * smiles: ** c(o)c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** ykbgvtzy...")
(Created page with "Category:metabolite == Metabolite GLY-tRNAs == * common-name: ** a trnagly == Reaction(s) known to consume the compound == * GLYCINE--TRNA-LIGASE-RXN == Reaction(s) kn...")
 
(3 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DEOXYGUANOSINE ==
+
== Metabolite GLY-tRNAs ==
 
* common-name:
 
* common-name:
** 2'-deoxyguanosine
+
** a trnagly
* smiles:
 
** c(o)c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
 
* inchi-key:
 
** ykbgvtzyehremt-kvqbguixsa-n
 
* molecular-weight:
 
** 267.244
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DEOXYGUANPHOSPHOR-RXN]]
+
* [[GLYCINE--TRNA-LIGASE-RXN]]
* [[DMPH]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DEOXYGUANPHOSPHOR-RXN]]
 
* [[DGTPTRIPHYDRO-RXN]]
 
* [[DMPH]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2'-deoxyguanosine}}
+
{{#set: common-name=a trnagly}}
{{#set: inchi-key=inchikey=ykbgvtzyehremt-kvqbguixsa-n}}
 
{{#set: molecular-weight=267.244}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite GLY-tRNAs

  • common-name:
    • a trnagly

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality