Difference between revisions of "GLYCERALD"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13717 == * common-name: ** l-selenocystathionine * smiles: ** c([se]cc(c([o-])=o)[n+])cc([n+])c(=o)[o-] * inchi-key: ** znwydqpouqrdl...") |
(Created page with "Category:metabolite == Metabolite p-his-tRNAS == * common-name: ** 5'-phospho-ribonucleotide-[trnahis] == Reaction(s) known to consume the compound == * RXN-12502 * ...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite p-his-tRNAS == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5'-phospho-ribonucleotide-[trnahis] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-12502]] |
| − | * [[RXN- | + | * [[RXN-12503]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5'-phospho-ribonucleotide-[trnahis]}} |
| − | |||
| − | |||
Revision as of 08:25, 15 March 2021
Contents
Metabolite p-his-tRNAS
- common-name:
- 5'-phospho-ribonucleotide-[trnahis]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "5'-phospho-ribonucleotide-[trnahis" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
