Difference between revisions of "GLYCERALD"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite OROTATE == * common-name: ** orotate * smiles: ** c1(=c(c([o-])=o)nc(nc(=o)1)=o) * inchi-key: ** pxqpewdeaktcgb-uhfffaoysa-m * molecular-...") |
(Created page with "Category:metabolite == Metabolite GLYCERALD == * common-name: ** d-glyceraldehyde * smiles: ** [ch](=o)c(o)co * inchi-key: ** mnqzxjomywmbou-vkhmyheasa-n * molecular-weigh...") |
||
(3 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite GLYCERALD == |
* common-name: | * common-name: | ||
− | ** | + | ** d-glyceraldehyde |
* smiles: | * smiles: | ||
− | ** | + | ** [ch](=o)c(o)co |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** mnqzxjomywmbou-vkhmyheasa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 90.079 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[ALCD19]] |
− | * [[ | + | * [[GLYCEROL-DEHYDROGENASE-NADP+-RXN]] |
+ | * [[RXN-15115]] | ||
+ | * [[TRIOKINASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[ALCD19]] |
− | * [[ | + | * [[GLYCEROL-DEHYDROGENASE-NADP+-RXN]] |
− | * [[ | + | * [[RXN-15115]] |
− | + | * [[RXN-8631]] | |
− | * [[ | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=d-glyceraldehyde}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mnqzxjomywmbou-vkhmyheasa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=90.079}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite GLYCERALD
- common-name:
- d-glyceraldehyde
- smiles:
- [ch](=o)c(o)co
- inchi-key:
- mnqzxjomywmbou-vkhmyheasa-n
- molecular-weight:
- 90.079