Difference between revisions of "GLYCERALD"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite OROTATE == * common-name: ** orotate * smiles: ** c1(=c(c([o-])=o)nc(nc(=o)1)=o) * inchi-key: ** pxqpewdeaktcgb-uhfffaoysa-m * molecular-...") |
(Created page with "Category:metabolite == Metabolite Glycerolipids == * common-name: ** a glycerolipid == Reaction(s) known to consume the compound == * RXN-16042 * RXN-16044 * RXN...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Glycerolipids == |
* common-name: | * common-name: | ||
| − | ** | + | ** a glycerolipid |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-16042]] |
| − | * [[ | + | * [[RXN-16044]] |
| + | * [[RXN-16150]] | ||
| + | * [[RXN-16151]] | ||
| + | * [[RXN-16152]] | ||
| + | * [[RXN-16157]] | ||
| + | * [[RXN-16158]] | ||
| + | * [[RXN-17688]] | ||
| + | * [[RXN-9670]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-16041]] |
| − | * [[ | + | * [[RXN-16043]] |
| − | * [[ | + | * [[RXN-16045]] |
| − | * [[ | + | * [[RXN-16138]] |
| − | * [[ | + | * [[RXN-16139]] |
| + | * [[RXN-16150]] | ||
| + | * [[RXN-16151]] | ||
| + | * [[RXN-16157]] | ||
| + | * [[RXN-16158]] | ||
| + | * [[RXN-17688]] | ||
| + | * [[RXN-9670]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a glycerolipid}} |
| − | |||
| − | |||
