Difference between revisions of "GLYCERATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-16475 == * common-name: ** β-d-galactosyl-(1→4)-[α-l-fucosyl-(1→3)]-n-acetyl-β-d-glucosamine * smiles: ** c...")
(Created page with "Category:metabolite == Metabolite GLYCERATE == * common-name: ** d-glycerate * smiles: ** c(=o)([o-])c(o)co * inchi-key: ** rbnpomfgqqghho-uwtatzphsa-m * molecular-weight:...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-16475 ==
+
== Metabolite GLYCERATE ==
 
* common-name:
 
* common-name:
** β-d-galactosyl-(1→4)-[α-l-fucosyl-(1→3)]-n-acetyl-β-d-glucosamine
+
** d-glycerate
 
* smiles:
 
* smiles:
** cc3(c(o)c(o)c(o)c(oc2(c(nc(c)=o)c(o)oc(co)c(oc1(oc(co)c(o)c(o)c(o)1))2))o3)
+
** c(=o)([o-])c(o)co
 
* inchi-key:
 
* inchi-key:
** hbbozfuqjdyasd-qgtnpelvsa-n
+
** rbnpomfgqqghho-uwtatzphsa-m
 
* molecular-weight:
 
* molecular-weight:
** 529.494
+
** 105.07
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15268]]
+
* [[GLY3KIN-RXN]]
 +
* [[HYDROXYPYRUVATE-REDUCTASE-RXN]]
 +
* [[RXN-15115]]
 +
* [[RXN0-5289]]
 +
* [[biomass_rxn]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15268]]
+
* [[HYDROXYPYRUVATE-REDUCTASE-RXN]]
 +
* [[RXN-15115]]
 +
* [[RXN0-5289]]
 +
* [[TSA-REDUCT-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-d-galactosyl-(1→4)-[α-l-fucosyl-(1→3)]-n-acetyl-β-d-glucosamine}}
+
{{#set: common-name=d-glycerate}}
{{#set: inchi-key=inchikey=hbbozfuqjdyasd-qgtnpelvsa-n}}
+
{{#set: inchi-key=inchikey=rbnpomfgqqghho-uwtatzphsa-m}}
{{#set: molecular-weight=529.494}}
+
{{#set: molecular-weight=105.07}}

Latest revision as of 11:17, 18 March 2021

Metabolite GLYCERATE

  • common-name:
    • d-glycerate
  • smiles:
    • c(=o)([o-])c(o)co
  • inchi-key:
    • rbnpomfgqqghho-uwtatzphsa-m
  • molecular-weight:
    • 105.07

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality