Difference between revisions of "GLYCEROPHOSPHOGLYCEROL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite yW-72 == * common-name: ** 7-[(3s)-(3-amino-3-carboxypropyl)]-wyosine37 in trnaphe == Reaction(s) known to consume the compound == * RX...")
(Created page with "Category:metabolite == Metabolite GLYCEROPHOSPHOGLYCEROL == * common-name: ** glycerophosphoglycerol * smiles: ** c(c(cop(occ(co)o)([o-])=o)o)o * inchi-key: ** llcsxhmjulh...")
 
(6 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite yW-72 ==
+
== Metabolite GLYCEROPHOSPHOGLYCEROL ==
 
* common-name:
 
* common-name:
** 7-[(3s)-(3-amino-3-carboxypropyl)]-wyosine37 in trnaphe
+
** glycerophosphoglycerol
 +
* smiles:
 +
** c(c(cop(occ(co)o)([o-])=o)o)o
 +
* inchi-key:
 +
** llcsxhmjulhsjn-uhfffaoysa-m
 +
* molecular-weight:
 +
** 245.146
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14528]]
+
* [[RXN-14073]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=7-[(3s)-(3-amino-3-carboxypropyl)]-wyosine37 in trnaphe}}
+
{{#set: common-name=glycerophosphoglycerol}}
 +
{{#set: inchi-key=inchikey=llcsxhmjulhsjn-uhfffaoysa-m}}
 +
{{#set: molecular-weight=245.146}}

Latest revision as of 11:11, 18 March 2021

Metabolite GLYCEROPHOSPHOGLYCEROL

  • common-name:
    • glycerophosphoglycerol
  • smiles:
    • c(c(cop(occ(co)o)([o-])=o)o)o
  • inchi-key:
    • llcsxhmjulhsjn-uhfffaoysa-m
  • molecular-weight:
    • 245.146

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality