Difference between revisions of "GLYCEROPHOSPHOGLYCEROL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9039 == * common-name: ** cobalt-precorrin-2 * smiles: ** cc3(c4(=cc1(=[n+]6(c(c(c1ccc([o-])=o)(cc(=o)[o-])c)=cc2(n5(c(=c(c=2cc(=o)[o...") |
(Created page with "Category:metabolite == Metabolite GLYCEROPHOSPHOGLYCEROL == * common-name: ** glycerophosphoglycerol * smiles: ** c(c(cop(occ(co)o)([o-])=o)o)o * inchi-key: ** llcsxhmjulh...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite GLYCEROPHOSPHOGLYCEROL == |
* common-name: | * common-name: | ||
| − | ** | + | ** glycerophosphoglycerol |
* smiles: | * smiles: | ||
| − | ** | + | ** c(c(cop(occ(co)o)([o-])=o)o)o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** llcsxhmjulhsjn-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 245.146 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-14073]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=glycerophosphoglycerol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=llcsxhmjulhsjn-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=245.146}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite GLYCEROPHOSPHOGLYCEROL
- common-name:
- glycerophosphoglycerol
- smiles:
- c(c(cop(occ(co)o)([o-])=o)o)o
- inchi-key:
- llcsxhmjulhsjn-uhfffaoysa-m
- molecular-weight:
- 245.146
