Difference between revisions of "GLYCGREAT-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15566 CPD-15566] == * common-name: ** (2e,4e)-tetradecadienoyl-coa * smiles: ** cccccccccc=...")
 
(Created page with "Category:pathway == Pathway GLYCGREAT-PWY == * taxonomic-range: ** tax-7742 * common-name: ** creatine biosynthesis == Reaction(s) found == * GUANIDINOACETATE-N-METHYLTR...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15566 CPD-15566] ==
+
== Pathway GLYCGREAT-PWY ==
 +
* taxonomic-range:
 +
** tax-7742
 
* common-name:
 
* common-name:
** (2e,4e)-tetradecadienoyl-coa
+
** creatine biosynthesis
* smiles:
+
== Reaction(s) found ==
** cccccccccc=cc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
* [[GUANIDINOACETATE-N-METHYLTRANSFERASE-RXN]]
* inchi-key:
+
== Reaction(s) not found ==
** ulogshzmdlrqry-inbgbncrsa-j
+
* [NoneGLYCINE-AMIDINOTRANSFERASE-RXN GLYCINE-AMIDINOTRANSFERASE-RXN]
* molecular-weight:
+
{{#set: taxonomic-range=tax-7742}}
** 969.83
+
{{#set: common-name=creatine biosynthesis}}
== Reaction(s) known to consume the compound ==
+
{{#set: nb reaction found=1}}
* [[RXN-14715]]
+
{{#set: completion rate=0.5}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb total reaction=2}}
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=(2e,4e)-tetradecadienoyl-coa}}
 
{{#set: inchi-key=inchikey=ulogshzmdlrqry-inbgbncrsa-j}}
 
{{#set: molecular-weight=969.83}}
 

Latest revision as of 10:58, 18 March 2021

Pathway GLYCGREAT-PWY

  • taxonomic-range:
    • tax-7742
  • common-name:
    • creatine biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneGLYCINE-AMIDINOTRANSFERASE-RXN GLYCINE-AMIDINOTRANSFERASE-RXN]