Difference between revisions of "GLYCGREAT-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15566 CPD-15566] == * common-name: ** (2e,4e)-tetradecadienoyl-coa * smiles: ** cccccccccc=...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1091 CPD-1091] == * common-name: ** (s)-ureidoglycolate * smiles: ** c(o)(c([o-])=o)nc(n)=o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15566 CPD-15566] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1091 CPD-1091] ==
 
* common-name:
 
* common-name:
** (2e,4e)-tetradecadienoyl-coa
+
** (s)-ureidoglycolate
 
* smiles:
 
* smiles:
** cccccccccc=cc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** c(o)(c([o-])=o)nc(n)=o
 
* inchi-key:
 
* inchi-key:
** ulogshzmdlrqry-inbgbncrsa-j
+
** nwzyycviokvtii-sfowxeaesa-m
 
* molecular-weight:
 
* molecular-weight:
** 969.83
+
** 133.083
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14715]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ALLANTOICASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,4e)-tetradecadienoyl-coa}}
+
{{#set: common-name=(s)-ureidoglycolate}}
{{#set: inchi-key=inchikey=ulogshzmdlrqry-inbgbncrsa-j}}
+
{{#set: inchi-key=inchikey=nwzyycviokvtii-sfowxeaesa-m}}
{{#set: molecular-weight=969.83}}
+
{{#set: molecular-weight=133.083}}

Revision as of 14:18, 26 August 2019

Metabolite CPD-1091

  • common-name:
    • (s)-ureidoglycolate
  • smiles:
    • c(o)(c([o-])=o)nc(n)=o
  • inchi-key:
    • nwzyycviokvtii-sfowxeaesa-m
  • molecular-weight:
    • 133.083

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality