Difference between revisions of "GLYCLEAV-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYSTINE CYSTINE] == * common-name: ** l-cystine * smiles: ** c(c(c(=o)[o-])[n+])sscc(c([o-])=o)...")
 
(Created page with "Category:pathway == Pathway GLYCLEAV-PWY == * taxonomic-range: ** tax-2157 ** tax-2759 ** tax-2 * common-name: ** glycine cleavage == Reaction(s) found == * GCVP-RXN *...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYSTINE CYSTINE] ==
+
== Pathway GLYCLEAV-PWY ==
 +
* taxonomic-range:
 +
** tax-2157
 +
** tax-2759
 +
** tax-2
 
* common-name:
 
* common-name:
** l-cystine
+
** glycine cleavage
* smiles:
+
== Reaction(s) found ==
** c(c(c(=o)[o-])[n+])sscc(c([o-])=o)[n+]
+
* [[GCVP-RXN]]
* inchi-key:
+
* [[GCVT-RXN]]
** levwyrkdkasidu-imjsidkusa-n
+
* [[RXN-8629]]
* molecular-weight:
+
== Reaction(s) not found ==
** 240.292
+
All reactions of this pathways are in present
== Reaction(s) known to consume the compound ==
+
{{#set: taxonomic-range=tax-2|tax-2157|tax-2759}}
* [[CYSTHIOCYS-RXN]]
+
{{#set: common-name=glycine cleavage}}
* [[RXN-15128]]
+
{{#set: nb reaction found=3}}
== Reaction(s) known to produce the compound ==
+
{{#set: completion rate=1.0}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb total reaction=3}}
{{#set: common-name=l-cystine}}
 
{{#set: inchi-key=inchikey=levwyrkdkasidu-imjsidkusa-n}}
 
{{#set: molecular-weight=240.292}}
 

Latest revision as of 10:58, 18 March 2021

Pathway GLYCLEAV-PWY

  • taxonomic-range:
    • tax-2157
    • tax-2759
    • tax-2
  • common-name:
    • glycine cleavage

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present