Difference between revisions of "GLYCOCAT-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14873 CPD-14873] == * common-name: ** 3-amino-4-hydroxybenzoate * smiles: ** c(=o)([o-])c1(...")
 
(Created page with "Category:pathway == Pathway GLYCOCAT-PWY == * taxonomic-range: ** tax-2 * common-name: ** glycogen degradation i == Reaction(s) found == * GLUCOKIN-RXN * GLYCOPHOSPH...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14873 CPD-14873] ==
+
== Pathway GLYCOCAT-PWY ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** 3-amino-4-hydroxybenzoate
+
** glycogen degradation i
* smiles:
+
== Reaction(s) found ==
** c(=o)([o-])c1(c=c(n)c(o)=cc=1)
+
* [[GLUCOKIN-RXN]]
* inchi-key:
+
* [[GLYCOPHOSPHORYL-RXN]]
** mrbkrzapgucwos-uhfffaoysa-m
+
* [[PHOSPHOGLUCMUT-RXN]]
* molecular-weight:
+
* [[RXN-9025]]
** 152.129
+
* [[RXN0-5182]]
== Reaction(s) known to consume the compound ==
+
* [[RXN0-5183]]
* [[RXN-15414]]
+
== Reaction(s) not found ==
== Reaction(s) known to produce the compound ==
+
* [NoneAMYLOMALT-RXN AMYLOMALT-RXN]
== Reaction(s) of unknown directionality ==
+
* [NoneRXN-21092 RXN-21092]
{{#set: common-name=3-amino-4-hydroxybenzoate}}
+
* [NoneRXN0-5146 RXN0-5146]
{{#set: inchi-key=inchikey=mrbkrzapgucwos-uhfffaoysa-m}}
+
{{#set: taxonomic-range=tax-2}}
{{#set: molecular-weight=152.129}}
+
{{#set: common-name=glycogen degradation i}}
 +
{{#set: nb reaction found=6}}
 +
{{#set: completion rate=0.75}}
 +
{{#set: nb total reaction=8}}

Latest revision as of 10:58, 18 March 2021

Pathway GLYCOCAT-PWY

  • taxonomic-range:
    • tax-2
  • common-name:
    • glycogen degradation i

Reaction(s) found

Reaction(s) not found

  • [NoneAMYLOMALT-RXN AMYLOMALT-RXN]
  • [NoneRXN-21092 RXN-21092]
  • [NoneRXN0-5146 RXN0-5146]