Difference between revisions of "GLYCOCAT-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14873 CPD-14873] == * common-name: ** 3-amino-4-hydroxybenzoate * smiles: ** c(=o)([o-])c1(...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRANS-D2-ENOYL-COA TRANS-D2-ENOYL-COA] == * common-name: ** a (2e)-alkan-2-enoyl-coa == Reactio...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14873 CPD-14873] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRANS-D2-ENOYL-COA TRANS-D2-ENOYL-COA] ==
 
* common-name:
 
* common-name:
** 3-amino-4-hydroxybenzoate
+
** a (2e)-alkan-2-enoyl-coa
* smiles:
 
** c(=o)([o-])c1(c=c(n)c(o)=cc=1)
 
* inchi-key:
 
** mrbkrzapgucwos-uhfffaoysa-m
 
* molecular-weight:
 
** 152.129
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15414]]
+
* [[ENOYL-COA-DELTA-ISOM-RXN]]
 +
* [[ENOYL-COA-HYDRAT-RXN]]
 +
* [[RXN-7699]]
 +
* [[RXN-7836]]
 +
* [[TRANSENOYLCOARED-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ACYL-COA-OXIDASE-RXN]]
 +
* [[ACYLCOADEHYDROG-RXN]]
 +
* [[ENOYL-COA-DELTA-ISOM-RXN]]
 +
* [[RXN-11026]]
 +
* [[RXN-7699]]
 +
* [[RXN-7836]]
 +
* [[RXN-7911]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-amino-4-hydroxybenzoate}}
+
{{#set: common-name=a (2e)-alkan-2-enoyl-coa}}
{{#set: inchi-key=inchikey=mrbkrzapgucwos-uhfffaoysa-m}}
 
{{#set: molecular-weight=152.129}}
 

Revision as of 14:19, 26 August 2019