Difference between revisions of "GLYCOGENIN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Charged-GLT-tRNAs == * common-name: ** an l-glutamyl-[trnaglu] == Reaction(s) known to consume the compound == * GLUTRNAREDUCT-RXN ==...")
(Created page with "Category:metabolite == Metabolite INDOXYL == * common-name: ** indoxyl * smiles: ** c2(c=cc1(=c(c(o)=cn1)c=2)) * inchi-key: ** pckpvgolpkluhr-uhfffaoysa-n * molecular-weig...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Charged-GLT-tRNAs ==
+
== Metabolite INDOXYL ==
 
* common-name:
 
* common-name:
** an l-glutamyl-[trnaglu]
+
** indoxyl
 +
* smiles:
 +
** c2(c=cc1(=c(c(o)=cn1)c=2))
 +
* inchi-key:
 +
** pckpvgolpkluhr-uhfffaoysa-n
 +
* molecular-weight:
 +
** 133.149
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GLUTRNAREDUCT-RXN]]
+
* [[RXN-15587]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GLURS-RXN]]
+
* [[RXN-15587]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an l-glutamyl-[trnaglu]}}
+
{{#set: common-name=indoxyl}}
 +
{{#set: inchi-key=inchikey=pckpvgolpkluhr-uhfffaoysa-n}}
 +
{{#set: molecular-weight=133.149}}

Revision as of 11:16, 15 January 2021

Metabolite INDOXYL

  • common-name:
    • indoxyl
  • smiles:
    • c2(c=cc1(=c(c(o)=cn1)c=2))
  • inchi-key:
    • pckpvgolpkluhr-uhfffaoysa-n
  • molecular-weight:
    • 133.149

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality