Difference between revisions of "GLYCOGENIN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite INDOXYL == * common-name: ** indoxyl * smiles: ** c2(c=cc1(=c(c(o)=cn1)c=2)) * inchi-key: ** pckpvgolpkluhr-uhfffaoysa-n * molecular-weig...") |
(Created page with "Category:metabolite == Metabolite GLYCOGENIN == * common-name: ** a [glycogenin] == Reaction(s) known to consume the compound == * GLYCOGENIN-GLUCOSYLTRANSFERASE-RXN =...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite GLYCOGENIN == |
* common-name: | * common-name: | ||
− | ** | + | ** a [glycogenin] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[GLYCOGENIN-GLUCOSYLTRANSFERASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a [glycogenin]}} |
− | |||
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite GLYCOGENIN
- common-name:
- a [glycogenin]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [glycogenin" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.