Difference between revisions of "GLYCOLLATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12829 == * common-name: ** plastoquinol-9 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(c)=cccc(=cccc(c)=cccc(c)=ccc1(=cc(=c(c(...")
(Created page with "Category:metabolite == Metabolite GLYCOLLATE == * common-name: ** glycolate * smiles: ** c(c(=o)[o-])o * inchi-key: ** aemrfaofkbgasw-uhfffaoysa-m * molecular-weight: ** 7...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12829 ==
+
== Metabolite GLYCOLLATE ==
 
* common-name:
 
* common-name:
** plastoquinol-9
+
** glycolate
 
* smiles:
 
* smiles:
** cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(c)=cccc(=cccc(c)=cccc(c)=ccc1(=cc(=c(c(=c1o)c)c)o))c)c)c
+
** c(c(=o)[o-])o
 
* inchi-key:
 
* inchi-key:
** ijbljlrewplepb-iqsnhbbhsa-n
+
** aemrfaofkbgasw-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 751.23
+
** 75.044
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[GLYCOLATEDEHYDRO-RXN]]
 +
* [[HDAO10x]]
 +
* [[RXN-969]]
 +
* [[RXN0-7229]]
 +
* [[biomass_rxn]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-2762]]
+
* [[GLYOXYLATE-REDUCTASE-NADP+-RXN]]
 +
* [[GPH-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=plastoquinol-9}}
+
{{#set: common-name=glycolate}}
{{#set: inchi-key=inchikey=ijbljlrewplepb-iqsnhbbhsa-n}}
+
{{#set: inchi-key=inchikey=aemrfaofkbgasw-uhfffaoysa-m}}
{{#set: molecular-weight=751.23}}
+
{{#set: molecular-weight=75.044}}

Latest revision as of 11:12, 18 March 2021

Metabolite GLYCOLLATE

  • common-name:
    • glycolate
  • smiles:
    • c(c(=o)[o-])o
  • inchi-key:
    • aemrfaofkbgasw-uhfffaoysa-m
  • molecular-weight:
    • 75.044

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality