Difference between revisions of "GLYCYLGLYCINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-carboxy-3-dimethylammonio-propyl-L-his == * common-name: ** a 2-[(3s)-3-carboxy-3-(dimethylammonio)propyl]-l-histidine-[translation elo...") |
(Created page with "Category:metabolite == Metabolite BENZENE-NO2 == * common-name: ** nitrobenzene * smiles: ** c1(=cc=c(c=c1)[n+]([o-])=o) * inchi-key: ** lqnuzadurlcdlv-uhfffaoysa-n * mole...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite BENZENE-NO2 == |
* common-name: | * common-name: | ||
| − | ** | + | ** nitrobenzene |
| + | * smiles: | ||
| + | ** c1(=cc=c(c=c1)[n+]([o-])=o) | ||
| + | * inchi-key: | ||
| + | ** lqnuzadurlcdlv-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 123.111 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-3661]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=nitrobenzene}} |
| + | {{#set: inchi-key=inchikey=lqnuzadurlcdlv-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=123.111}} | ||
Revision as of 11:13, 15 January 2021
Contents
Metabolite BENZENE-NO2
- common-name:
- nitrobenzene
- smiles:
- c1(=cc=c(c=c1)[n+]([o-])=o)
- inchi-key:
- lqnuzadurlcdlv-uhfffaoysa-n
- molecular-weight:
- 123.111
