Difference between revisions of "GLYOX"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-Methyl-Saturated-Fatty-Acyl-CoA == * common-name: ** a 3-methyl-branched 2,3,4-saturated fatty acyl-coa == Reaction(s) known to consume...")
(Created page with "Category:metabolite == Metabolite CPD-11700 == * common-name: ** 1d-myo-inositol 1-diphosphate 2,3,4,5,6-pentakisphosphate * smiles: ** c1(op(=o)([o-])[o-])(c(op([o-])(=o)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-Methyl-Saturated-Fatty-Acyl-CoA ==
+
== Metabolite CPD-11700 ==
 
* common-name:
 
* common-name:
** a 3-methyl-branched 2,3,4-saturated fatty acyl-coa
+
** 1d-myo-inositol 1-diphosphate 2,3,4,5,6-pentakisphosphate
 +
* smiles:
 +
** c1(op(=o)([o-])[o-])(c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(op([o-])(=o)[o-])([o-])=o)c(op([o-])([o-])=o)c(op(=o)([o-])[o-])1)
 +
* inchi-key:
 +
** uphpwxpnziozjl-uotptpdrsa-a
 +
* molecular-weight:
 +
** 726.913
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-470]]
+
* [[RXN-10974]]
 +
* [[RXN-10975]]
 +
* [[RXN-10977]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-469]]
+
* [[RXN-10972]]
 +
* [[RXN-10975]]
 +
* [[RXN-10977]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 3-methyl-branched 2,3,4-saturated fatty acyl-coa}}
+
{{#set: common-name=1d-myo-inositol 1-diphosphate 2,3,4,5,6-pentakisphosphate}}
 +
{{#set: inchi-key=inchikey=uphpwxpnziozjl-uotptpdrsa-a}}
 +
{{#set: molecular-weight=726.913}}

Revision as of 14:59, 5 January 2021

Metabolite CPD-11700

  • common-name:
    • 1d-myo-inositol 1-diphosphate 2,3,4,5,6-pentakisphosphate
  • smiles:
    • c1(op(=o)([o-])[o-])(c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(op([o-])(=o)[o-])([o-])=o)c(op([o-])([o-])=o)c(op(=o)([o-])[o-])1)
  • inchi-key:
    • uphpwxpnziozjl-uotptpdrsa-a
  • molecular-weight:
    • 726.913

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality