Difference between revisions of "GLYOXDEG-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SQUALENE SQUALENE] == * common-name: ** squalene * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc=c(c)cc...")
 
(Created page with "Category:pathway == Pathway GLYOXDEG-PWY == * taxonomic-range: ** tax-2 * common-name: ** glycolate and glyoxylate degradation ii == Reaction(s) found == * GLYCOLATEDEHY...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SQUALENE SQUALENE] ==
+
== Pathway GLYOXDEG-PWY ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** squalene
+
** glycolate and glyoxylate degradation ii
* smiles:
+
== Reaction(s) found ==
** cc(c)=cccc(c)=cccc(c)=cccc=c(c)ccc=c(c)ccc=c(c)c
+
* [[GLYCOLATEDEHYDRO-RXN]]
* inchi-key:
+
* [[MALSYN-RXN]]
** yygntywphwgjrm-aajylucbsa-n
+
== Reaction(s) not found ==
* molecular-weight:
+
All reactions of this pathways are in present
** 410.725
+
{{#set: taxonomic-range=tax-2}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=glycolate and glyoxylate degradation ii}}
* [[SMO]]
+
{{#set: nb reaction found=2}}
* [[SQUALENE-MONOOXYGENASE-RXN]]
+
{{#set: completion rate=1.0}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb total reaction=2}}
* [[RXN-13162]]
 
* [[RXN-13724]]
 
* [[RXN66-281]]
 
* [[SMO]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=squalene}}
 
{{#set: inchi-key=inchikey=yygntywphwgjrm-aajylucbsa-n}}
 
{{#set: molecular-weight=410.725}}
 

Latest revision as of 11:00, 18 March 2021

Pathway GLYOXDEG-PWY

  • taxonomic-range:
    • tax-2
  • common-name:
    • glycolate and glyoxylate degradation ii

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present