Difference between revisions of "GLYOXDEG-PWY"

Revision as of 20:18, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-CARBOXY-3-HYDROXY-ISOCAPROATE 3-CARBOXY-3-HYDROXY-ISOCAPROATE] ==
+== Pathway PWY3O-355 ==
+* taxonomic-range:
+** tax-4751
 * common-name:
-** (2s)-2-isopropylmalate
+** stearate biosynthesis iii (fungi)
-* smiles:
+== Reaction(s) found ==
-** cc(c)c(o)(cc(=o)[o-])c([o-])=o
+* [[RXN-9624]]
-* inchi-key:
+* [[RXN-9633]]
-** bityxlxucsktjs-zetcqymhsa-l
+* [[RXN-9634]]
-* molecular-weight:
+* [[RXN3O-1803]]
-** 174.153
+* [[RXN3O-5293]]
-== Reaction(s) known to consume the compound ==
+* [[RXN3O-5304]]
-* [[3-ISOPROPYLMALISOM-RXN]]
+== Reaction(s) not found ==
-* [[RXN-13163]]
+* [NoneRXN-20769 RXN-20769]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-20770 RXN-20770]
-* [[2-ISOPROPYLMALATESYN-RXN]]
+{{#set: taxonomic-range=tax-4751}}
-* [[3-ISOPROPYLMALISOM-RXN]]
+{{#set: common-name=stearate biosynthesis iii (fungi)}}
-* [[IPMS]]
+{{#set: nb reaction found=6}}
-* [[RXN-13163]]
+{{#set: completion rate=1.0}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=6}}
-{{#set: common-name=(2s)-2-isopropylmalate}}
-{{#set: inchi-key=inchikey=bityxlxucsktjs-zetcqymhsa-l}}
-{{#set: molecular-weight=174.153}}