Difference between revisions of "GLYSYN-ALA-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-674 CPD-674] == * common-name: ** trans-cinnamate * smiles: ** c(=o)([o-])c=cc1(=cc=cc=c1)...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=25S-rRNA-adenine-645 25S-rRNA-adenine-645] == * common-name: ** adenine645 in 25s rrna == React...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-674 CPD-674] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=25S-rRNA-adenine-645 25S-rRNA-adenine-645] ==
 
* common-name:
 
* common-name:
** trans-cinnamate
+
** adenine645 in 25s rrna
* smiles:
 
** c(=o)([o-])c=cc1(=cc=cc=c1)
 
* inchi-key:
 
** wbywaxjhaxsjni-votsokgwsa-m
 
* molecular-weight:
 
** 147.153
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-2001]]
+
* [[RXN-14550]]
* [[TRANS-CINNAMATE-4-MONOOXYGENASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=trans-cinnamate}}
+
{{#set: common-name=adenine645 in 25s rrna}}
{{#set: inchi-key=inchikey=wbywaxjhaxsjni-votsokgwsa-m}}
 
{{#set: molecular-weight=147.153}}
 

Revision as of 09:22, 27 August 2019

Metabolite 25S-rRNA-adenine-645

  • common-name:
    • adenine645 in 25s rrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality