Difference between revisions of "GLYSYN-PWY"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ACYL-GPE 2-ACYL-GPE] == * common-name: ** a 2-acyl-1-lyso-phosphatidylethanolamine == Reactio...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19726 CPD-19726] == * common-name: ** (4s)-2,3-dehydro-leucocyanidin * smiles: ** c3(c(c2(o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19726 CPD-19726] == |
* common-name: | * common-name: | ||
| − | ** | + | ** (4s)-2,3-dehydro-leucocyanidin |
| + | * smiles: | ||
| + | ** c3(c(c2(oc1(c=c(c=c(c=1c(c=2o)o)o)o)))=cc(o)=c(c=3)o) | ||
| + | * inchi-key: | ||
| + | ** yaagnrwejszflv-zdusscgksa-n | ||
| + | * molecular-weight: | ||
| + | ** 304.256 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-602]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(4s)-2,3-dehydro-leucocyanidin}} |
| + | {{#set: inchi-key=inchikey=yaagnrwejszflv-zdusscgksa-n}} | ||
| + | {{#set: molecular-weight=304.256}} | ||
Revision as of 14:18, 26 August 2019
Contents
Metabolite CPD-19726
- common-name:
- (4s)-2,3-dehydro-leucocyanidin
- smiles:
- c3(c(c2(oc1(c=c(c=c(c=1c(c=2o)o)o)o)))=cc(o)=c(c=3)o)
- inchi-key:
- yaagnrwejszflv-zdusscgksa-n
- molecular-weight:
- 304.256
