Difference between revisions of "GLYSYN-THR-PWY"

Revision as of 20:17, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9870 CPD-9870] ==
+== Pathway PWY-4361 ==
+* taxonomic-range:
+** tax-33208
+** tax-2157
+** tax-2
+** tax-3193
 * common-name:
-** 2-methoxy-6-all trans-nonaprenyl-1,4-benzoquinol
+** s-methyl-5-thio-&alpha;-d-ribose 1-phosphate degradation
-* smiles:
+== Reaction(s) found ==
-** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c)c)c)c
+* [[5.3.1.23-RXN]]
-* inchi-key:
+* [[R145-RXN]]
-** skaoreknlokwtc-jsgwljpksa-n
+* [[R147-RXN]]
-* molecular-weight:
+== Reaction(s) not found ==
-** 753.202
+* [NoneRXN-15650 RXN-15650]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-13072 RXN-13072]
-* [[RXN-9242]]
+* [NoneR83-RXN R83-RXN]
-== Reaction(s) known to produce the compound ==
+* [NoneR82-RXN R82-RXN]
-== Reaction(s) of unknown directionality ==
+{{#set: taxonomic-range=tax-2|tax-2157|tax-33208|tax-3193}}
-{{#set: common-name=2-methoxy-6-all trans-nonaprenyl-1,4-benzoquinol}}
+{{#set: common-name=s-methyl-5-thio-&alpha;-d-ribose 1-phosphate degradation}}
-{{#set: inchi-key=inchikey=skaoreknlokwtc-jsgwljpksa-n}}
+{{#set: nb reaction found=3}}
-{{#set: molecular-weight=753.202}}
+{{#set: completion rate=0.43}}
+{{#set: nb total reaction=7}}