Difference between revisions of "GLYSYN-THR-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11647 CPD-11647] == * common-name: ** thermospermine * smiles: ** c([n+])ccc[n+]ccc[n+]ccc[...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9870 CPD-9870] == * common-name: ** 2-methoxy-6-all trans-nonaprenyl-1,4-benzoquinol * smil...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11647 CPD-11647] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9870 CPD-9870] ==
 
* common-name:
 
* common-name:
** thermospermine
+
** 2-methoxy-6-all trans-nonaprenyl-1,4-benzoquinol
 
* smiles:
 
* smiles:
** c([n+])ccc[n+]ccc[n+]ccc[n+]
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** doddbcgmrafleb-uhfffaoysa-r
+
** skaoreknlokwtc-jsgwljpksa-n
 
* molecular-weight:
 
* molecular-weight:
** 206.374
+
** 753.202
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11190]]
+
* [[RXN-9242]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11190]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=thermospermine}}
+
{{#set: common-name=2-methoxy-6-all trans-nonaprenyl-1,4-benzoquinol}}
{{#set: inchi-key=inchikey=doddbcgmrafleb-uhfffaoysa-r}}
+
{{#set: inchi-key=inchikey=skaoreknlokwtc-jsgwljpksa-n}}
{{#set: molecular-weight=206.374}}
+
{{#set: molecular-weight=753.202}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-9870

  • common-name:
    • 2-methoxy-6-all trans-nonaprenyl-1,4-benzoquinol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c)c)c)c
  • inchi-key:
    • skaoreknlokwtc-jsgwljpksa-n
  • molecular-weight:
    • 753.202

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality