Difference between revisions of "GMP"

Latest revision as of 11:15, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite VERY-LONG-CHAIN-FATTY-ACYL-COA ==
+== Metabolite GMP ==
 * common-name:
-** a very long chain fatty acyl-coa
+** gmp
+* smiles:
+** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
+* inchi-key:
+** rqfcjasxjcidsx-uuokfmhzsa-l
+* molecular-weight:
+** 361.207
 == Reaction(s) known to consume the compound ==
-* [[RXN3O-328]]
+* [[AGPT]]
+* [[GMP-REDUCT-RXN]]
+* [[GUANPRIBOSYLTRAN-RXN]]
+* [[GUANYL-KIN-RXN]]
+* [[RXN-7609]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-16415]]
+* [[3.6.1.17-RXN]]
+* [[35-CYCLIC-GMP-PHOSPHODIESTERASE-RXN]]
+* [[GMP-SYN-GLUT-RXN]]
+* [[GMP-SYN-NH3-RXN]]
+* [[GUANOSINE-DIPHOSPHATASE-RXN]]
+* [[GUANPRIBOSYLTRAN-RXN]]
+* [[NTDP]]
+* [[RXN-14140]]
+* [[RXN-14201]]
+* [[RXN-15713]]
+* [[RXN-17923]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=a very long chain fatty acyl-coa}}
+{{#set: common-name=gmp}}
+{{#set: inchi-key=inchikey=rqfcjasxjcidsx-uuokfmhzsa-l}}
+{{#set: molecular-weight=361.207}}