Difference between revisions of "GMP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15678 == * common-name: ** 4-trans-3-oxo-undecenoyl-coa * smiles: ** ccccccc=cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(o...")
(Created page with "Category:metabolite == Metabolite HEME_C == * common-name: ** heme c == Reaction(s) known to consume the compound == * HOLOCYTOCHROME-C-SYNTHASE-RXN == Reaction(s) kno...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15678 ==
+
== Metabolite HEME_C ==
 
* common-name:
 
* common-name:
** 4-trans-3-oxo-undecenoyl-coa
+
** heme c
* smiles:
 
** ccccccc=cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** xbfqfvlnmjddng-dupkwvsksa-j
 
* molecular-weight:
 
** 943.749
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14793]]
+
* [[HOLOCYTOCHROME-C-SYNTHASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[HOLOCYTOCHROME-C-SYNTHASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-trans-3-oxo-undecenoyl-coa}}
+
{{#set: common-name=heme c}}
{{#set: inchi-key=inchikey=xbfqfvlnmjddng-dupkwvsksa-j}}
 
{{#set: molecular-weight=943.749}}
 

Revision as of 14:58, 5 January 2021

Metabolite HEME_C

  • common-name:
    • heme c

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality