Difference between revisions of "GTP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ06889 == * transcription-direction: ** positive * right-end-position: ** 456508 * left-end-position: ** 418983 * centisome-position: ** 89.40917...")
(Created page with "Category:metabolite == Metabolite GTP == * common-name: ** gtp * smiles: ** c(op([o-])(=o)op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ06889 ==
+
== Metabolite GTP ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** gtp
−
* right-end-position:
+
* smiles:
−
** 456508
+
** c(op([o-])(=o)op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
−
* left-end-position:
+
* inchi-key:
−
** 418983
+
** xkmlyualxhknft-uuokfmhzsa-j
−
* centisome-position:
+
* molecular-weight:
−
** 89.40917   
+
** 519.151
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
−
== Reaction(s) associated ==
+
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
−
* [[RXN-15559]]
+
* [[FE2GTPabc]]
−
** Category: [[annotation]]
+
* [[GTCY]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[GTP-CYCLOHYDRO-I-RXN]]
−
* [[RXN-15560]]
+
* [[GTP-CYCLOHYDRO-II-RXN]]
−
** Category: [[annotation]]
+
* [[GTPPYPHOSKIN-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[GTUP]]
−
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
+
* [[GUANYLCYC-RXN]]
−
** Category: [[annotation]]
+
* [[MRNA-GUANYLYLTRANSFERASE-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[NTDP]]
−
** Category: [[orthology]]
+
* [[RXN-12502]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-12504]]
−
== Pathway(s) associated ==
+
* [[RXN-14140]]
−
* [[PWY-7511]]
+
* [[RXN-14201]]
−
** '''7''' reactions found over '''9''' reactions in the full pathway
+
* [[RXN-15713]]
−
{{#set: transcription-direction=positive}}
+
* [[RXN-17921]]
−
{{#set: right-end-position=456508}}
+
* [[RXN-8340]]
−
{{#set: left-end-position=418983}}
+
* [[RXN-8988]]
−
{{#set: centisome-position=89.40917    }}
+
* [[RXN0-5462]]
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[RXN0-746]]
−
{{#set: nb reaction associated=3}}
+
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
−
{{#set: nb pathway associated=1}}
+
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 +
* [[URKI-RXN]]
 +
</div>
 +
== Reaction(s) known to produce the compound ==
 +
* [[3.6.1.17-RXN]]
 +
* [[ATGD]]
 +
* [[GDPKIN-RXN]]
 +
* [[GTPOP]]
 +
* [[RXN-14117]]
 +
* [[RXN0-6427]]
 +
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 +
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=gtp}}
 +
{{#set: inchi-key=inchikey=xkmlyualxhknft-uuokfmhzsa-j}}
 +
{{#set: molecular-weight=519.151}}

Latest revision as of 11:15, 18 March 2021

Metabolite GTP

  • common-name:
    • gtp
  • smiles:
    • c(op([o-])(=o)op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
  • inchi-key:
    • xkmlyualxhknft-uuokfmhzsa-j
  • molecular-weight:
    • 519.151

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=GTP&oldid=138468"